| Amadis Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8992-5085 | |||
![]() |
sales@amadischem.com | |||
![]() |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink massive supplier since 2016 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Axon MedChem BV | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | Amino(3,5-Dihydroxyphenyl)Acetic Acid |
| Synonyms | (R,S)-3,5-DHPG; (RS)-3,5-DHPG; (RS)-3,5-Dihydroxyphenylglycine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 |
| CAS Registry Number | 19641-83-9 |
| SMILES | C1=C(C=C(C=C1O)O)C(C(=O)O)N |
| InChI | 1S/C8H9NO4/c9-7(8(12)13)4-1-5(10)3-6(11)2-4/h1-3,7,10-11H,9H2,(H,12,13) |
| InChIKey | HOOWCUZPEFNHDT-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.8±33.0°C at 760 mmHg (Cal.) |
| Flash point | 225.2±25.4°C (Cal.) |
| Refractive index | 1.68 (Cal.) |
| solubility | Soluble to 10 mM in water |
| Market Analysis Reports |