| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Phenylisatogen |
|---|---|
| Synonyms | 1-Oxido-2-Phenyl-Indol-1-Ium-3-One; 1-Oxido-2-Phenyl-3-Indol-1-Iumone; Nci60_008252 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 1969-74-0 |
| SMILES | [O+]C1=C([N](C2=CC=CC=C12)[O-])C3=CC=CC=C3 |
| InChI | 1S/C14H9NO2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9H |
| InChIKey | WXFLHMJSSLDOPA-UHFFFAOYSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Melting point | 186°C (Expl.) |
| Boiling point | 431.152°C at 760 mmHg (Cal.) |
| Flash point | 219.589°C (Cal.) |
| (1) | Paola Astolfi, Lucedio Greci, Corrado Rizzoli, Paolo Sgarabotto and Giancarlo Marrosu. Radical intermediates in the peroxidation of indoles, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 1634. |
|---|---|
| Market Analysis Reports |