Online Database of Chemicals from Around the World

2-Vinylhexafluoroisopropanol
[CAS 19701-19-0]

List of Suppliers
Fujian Wolfa Biotechnology Co., Ltd. China
www.wolfabio.com
+86 18050950397
jomin@wolfabio.com
WhatsApp:+86 18359103607
Chemical manufacturer since 2023
chemBlink Standard supplier since 2024
Ricci Chimica Italy
www.riccichimica.com
+39 (75) 692-9241
+39 (75) 592-6595
info@riccichimica.com
Chemical manufacturer
P and M Invest Ltd. Russia
www.fluorine.ru
+7 (495) 135-6494
+7 (495) 135-6509
sales@fluorine1.ru
Chemical manufacturer

Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Alcohol
Name2-Vinylhexafluoroisopropanol
Synonyms1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-ol
Molecular Structure2-Vinylhexafluoroisopropanol molecular structure (CAS 19701-19-0)
Molecular FormulaC5H4F6O
Molecular Weight194.07
CAS Registry Number19701-19-0
EC Number821-639-9
SMILESC=CC(C(F)(F)F)(C(F)(F)F)O
Safety Data
Hazard Symbolssymbol   GHS05 Danger  Details
Risk StatementsH314  Details
Safety StatementsP260-P264-P280-P301+P330+P331-P302+P361+P354-P304+P340-P305+P354+P338-P316-P321-P363-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Skin corrosionSkin Corr.1BH314
SDSAvailable
up Discovery and Applications
2-Vinylhexafluoroisopropanol is an organofluorine compound with the chemical formula C9H6F6O. It features a vinyl group attached to a hexafluoroisopropanol structure. The discovery of this compound emerged from research focused on developing fluorinated alcohols with unique chemical properties, particularly those involving fluorinated hydrocarbons.

The synthesis of 2-vinylhexafluoroisopropanol typically involves the reaction of hexafluoroisopropanol with a suitable vinylating agent under controlled conditions. One common method involves the use of a vinyl halide in the presence of a base to facilitate the vinylation reaction. This process ensures that the vinyl group is successfully introduced into the hexafluoroisopropanol molecule, resulting in the formation of 2-vinylhexafluoroisopropanol.

2-Vinylhexafluoroisopropanol has found significant applications in various fields due to its unique fluorinated structure. In polymer chemistry, it is used as a monomer or co-monomer in the production of fluorinated polymers. These polymers are valued for their chemical resistance, thermal stability, and low surface energy, making them ideal for use in applications such as coatings, films, and sealants.

The compound is also utilized in the development of specialty materials and additives. For example, it is used in the formulation of high-performance lubricants and hydraulic fluids, where its fluorinated nature contributes to enhanced stability and resistance to oxidation and degradation. Additionally, 2-vinylhexafluoroisopropanol is employed in the creation of advanced materials with specific properties tailored to industrial needs.

In the field of organic synthesis, 2-vinylhexafluoroisopropanol serves as a valuable building block for the construction of more complex fluorinated compounds. Its reactivity and unique chemical properties make it a useful intermediate in the synthesis of fluorinated pharmaceuticals, agrochemicals, and other fine chemicals.

Overall, 2-vinylhexafluoroisopropanol is a versatile chemical with applications spanning polymer chemistry, specialty materials, and organic synthesis. Its discovery and utilization have contributed to advancements in various industrial and research areas, highlighting the importance of fluorinated compounds in modern chemistry.

References

none
Market Analysis Reports
Related Products
2-Vinylfuran  Vinyl 2-Furoate  5-Vinylfuro[2,3...  R(-)-gamma-Viny...  Vinyl Glucopyra...  (3S)-4a-Vinyl-3...  Vinylglycine  Vinyl glyoxylat...  Vinyl Heptafluo...  Vinyl (2E,4E)-2...  2-Vinylhexahydr...  (3aR,7aS)-7A-Vi...  (3aR,7aR)-7A-Vi...  (3aR,6aS)-6A-Vi...  (4aS,7R,7aS)-7-...  (3aR,5R,6aR)-5-...  (1R,7aS)-1-Viny...  Vinyl Hexanoate  3-(1-Vinylhexyl...  1-Vinylhexyl He...