| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Di-m-Tolyl Ether |
|---|---|
| Synonyms | Zinc02381218; Benzene, 1,1'-Oxybis(3-Methyl-; Di-M-Tolyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 |
| CAS Registry Number | 19814-71-2 |
| EINECS | 243-343-3 |
| SMILES | C2=C(OC1=CC=CC(=C1)C)C=CC=C2C |
| InChI | 1S/C14H14O/c1-11-5-3-7-13(9-11)15-14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | FDLFMPKQBNPIER-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.152°C at 760 mmHg (Cal.) |
| Flash point | 121.713°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |