| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 7-Oxa-7H-benz[de]anthracene |
|---|---|
| Synonyms | Mls000736881; Smr000444166; Benzo(K L)Xanthene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 |
| CAS Registry Number | 200-23-7 |
| EINECS | 205-901-4 |
| SMILES | C4=C3OC1=CC=CC2=C1C(=CC=C2)C3=CC=C4 |
| InChI | 1S/C16H10O/c1-2-9-14-12(7-1)13-8-3-5-11-6-4-10-15(17-14)16(11)13/h1-10H |
| InChIKey | QKOSFCWXOIAFTO-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.139°C at 760 mmHg (Cal.) |
| Flash point | 191.154°C (Cal.) |
| (1) | Simone Di Micco, Frédéric Mazué, Carmelo Daquino, Carmela Spatafora, Dominique Delmas, Norbert Latruffe, Corrado Tringali, Raffaele Riccio and Giuseppe Bifulco. Structural basis for the potential antitumour activity of DNA-interacting benzo[kl]xanthene lignans, Org. Biomol. Chem., 2011, 9, 701. |
|---|---|
| Market Analysis Reports |