| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-Phenylethyl methanesulphonate |
|---|---|
| Synonyms | Methanesulfonic Acid 2-Phenylethyl Ester; Methanesulfonic Acid, Phenethyl Ester; Phenethyl Mesylate |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.25 |
| CAS Registry Number | 20020-27-3 |
| SMILES | C1=C(CCO[S](C)(=O)=O)C=CC=C1 |
| InChI | 1S/C9H12O3S/c1-13(10,11)12-8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | NCLPKLKVZDQOFW-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.137°C at 760 mmHg (Cal.) |
| Flash point | 170.396°C (Cal.) |
| (1) | Jun-ichi Morita, Hidefumi Nakatsuji, Tomonori Misaki and Yoo Tanabe. Water-solvent method for tosylation and mesylation of primary alcohols promoted by KOH and catalytic amines, Green Chem., 2005, 7, 711. |
|---|---|
| Market Analysis Reports |