| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl (2E)-2-Cyano-3-(4-Methylphenyl)Acrylate |
|---|---|
| Synonyms | (E)-Ethyl 2-cyano-3-(4-methylphenyl)acrylate; Ethyl (2E)-2-cyano-3-(4-methylphenyl)-2-propenoate #; Ethyl (2E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 2017-88-1 |
| SMILES | N#C\C(=C/c1ccc(cc1)C)C(=O)OCC |
| InChI | 1S/C13H13NO2/c1-3-16-13(15)12(9-14)8-11-6-4-10(2)5-7-11/h4-8H,3H2,1-2H3/b12-8+ |
| InChIKey | KKIZDEFOEGGSKX-XYOKQWHBSA-N |
| Density | 1.116g/cm3 (Cal.) |
|---|---|
| Melting point | 86-89°C (Expl.) |
| Boiling point | 348.751°C at 760 mmHg (Cal.) |
| Flash point | 166.135°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Safety Description | Irritant |
|---|---|
| IRRITANT | |
| SDS | Available |
| (1) | Y. He, J. Shi and G. Su. Structure of ethyl 2-cyano-3-(4-methylphenyl)propenoate, Acta Cryst. (1993). C49, 2000-2002 |
|---|---|
| Market Analysis Reports |