| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | 5-Bromo-2-Fluorobenzylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8BrFN |
| Molecular Weight | 205.05 |
| CAS Registry Number | 202865-69-8 |
| SMILES | C1=C(Br)C=CC(=C1C[NH3+])F |
| InChI | 1S/C7H7BrFN/c8-6-1-2-7(9)5(3-6)4-10/h1-3H,4,10H2/p+1 |
| InChIKey | PDKBJZGGXHTHNC-UHFFFAOYSA-O |
| Boiling point | 243.771°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 101.229°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |