|
CAS#: 20367-33-3 Product: N-(2-Nitro-4-Propoxyphenyl)Acetamide No suppilers available for the product. |
| Name | N-(2-Nitro-4-Propoxyphenyl)Acetamide |
|---|---|
| Synonyms | N-(2-Nitro-4-Propoxy-Phenyl)Acetamide; N-(2-Nitro-4-Propoxy-Phenyl)Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 20367-33-3 |
| EINECS | 243-767-9 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1OCCC)NC(=O)C |
| InChI | 1S/C11H14N2O4/c1-3-6-17-9-4-5-10(12-8(2)14)11(7-9)13(15)16/h4-5,7H,3,6H2,1-2H3,(H,12,14) |
| InChIKey | SCCDPJHRMIEZGA-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.834°C at 760 mmHg (Cal.) |
| Flash point | 222.828°C (Cal.) |
| (1) | H. S. Yathirajan, S. Bindya, M. A. Ashok, B. Narayana and M. Bolte. N-(2-Nitro-4-propoxyphenyl)acetamide, Acta Cryst. (2007). E63, o2202-o2203 |
|---|---|
| Market Analysis Reports |