| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Polyethylene Glycol Mono-4-Nonylphenyl Ether |
|---|---|
| Synonyms | 238635_Aldrich; Igepal Co-210; Polyoxyethylene(2) Nonylphenyl Ether, Branched |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 |
| CAS Registry Number | 20427-84-3 |
| EINECS | 243-816-4 |
| SMILES | C1=CC(=CC=C1CCCCCCCCC)OCCOCCO |
| InChI | 1S/C19H32O3/c1-2-3-4-5-6-7-8-9-18-10-12-19(13-11-18)22-17-16-21-15-14-20/h10-13,20H,2-9,14-17H2,1H3 |
| InChIKey | BLXVTZPGEOGTGG-UHFFFAOYSA-N |
| Density | 0.979g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.15°C at 760 mmHg (Cal.) |
| Flash point | 217.576°C (Cal.) |
| (1) | Castillo M, Riu J, Ventura F, Boleda R, Scheding R, Schröder H.Fr, Nistor C, Émneus J, Eichhorn P, Knepper Th.P, Jonkers C.C.A, de Voogt P, González-Mazo E, León V.M, Barceló D. Inter-laboratory comparison of liquid chromatographic techniques and enzyme-linked immunosorbent assay for the determination of surfactants in wastewaters, Journal of Chromatography A, 2000 |
|---|---|
| Market Analysis Reports |