| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Chemical reagent >> Organic reagent >> Boric acid |
|---|---|
| Name | Dimesitylborinic acid |
| Synonyms | bis(2-mesityl)borinic acid; dimesityl borinic acid; Dimesitylborinic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23BO |
| Molecular Weight | 266.19 |
| CAS Registry Number | 20631-84-9 |
| SMILES | B(C1=C(C=C(C=C1C)C)C)(C2=C(C=C(C=C2C)C)C)O |
| InChI | 1S/C18H23BO/c1-11-7-13(3)17(14(4)8-11)19(20)18-15(5)9-12(2)10-16(18)6/h7-10,20H,1-6H3 |
| InChIKey | OTYVTANMHIUXBQ-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 199.0±31.5°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Samuel J. Birch, Sally R. Boss, Sarah C. Cole, Martyn P. Coles, Robert Haigh, Peter B. Hitchcock and Andrew E. H. Wheatley. The structural characteristics of organozinc complexes incorporating N,N′-bidentate ligands, Dalton Trans., 2004, 0, 3568. |
|---|---|
| Market Analysis Reports |