| AK Scientific, Inc | USA | |||
|---|---|---|---|---|
![]() |
+1 (510) 429-8835 | |||
![]() |
sales@aksci.com | |||
| Chemical manufacturer | ||||
| AOBChem USA | USA | |||
|---|---|---|---|---|
![]() |
+1 (323) 382-7678 | |||
![]() |
sales@aobchem.com | |||
| Chemical manufacturer | ||||
| Acorn PharmaTech, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (650) 353-2487 | |||
![]() |
sales@acornpharmatech.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomole Scientific Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| BoroChem | France | |||
|---|---|---|---|---|
![]() |
+33 (2) 3194-5073 | |||
![]() |
info@borochem.fr | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | 4-Methyl-N-Phenylaniline |
|---|---|
| Synonyms | (4-methylphenyl)phenylamine; 4-Methyldiphenylamine; 4-METHYL-N-PHENYLBENZAMINE |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 |
| CAS Registry Number | 206559-40-2 |
| SMILES | CC1=CC=C(C=C1)NC2=CC=CC=C2 |
| InChI | 1S/C13H13N/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-10,14H,1H3 |
| InChIKey | AGHYMXKKEXDUTA-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 90°C (Expl.) |
| Boiling point | 334°C (Expl.) |
| 333.999°C at 760 mmHg (Cal.) | |
| Flash point | 154.9±14.7°C (Cal.) |
| 155°C (Expl.) | |
| Refractive index | 1.622 (Cal.) |
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R21/22;R36/38 Details |
| Hazard Symbol | X Details |
| Safety Description | IRRITANT |
| WARNING:Harmful by skin absorption/ingestion, irritates skin | |
| WARNING: Irritates lungs, eyes, skin | |
| SDS | Available |
| (1) | Baoda Lin, Miaochang Liu, Zhishi Ye, Jinchang Ding, Huayue Wu and Jiang Cheng. Copper-TBAF catalyzed arylation of amines and amides with aryl trimethoxysilane, Org. Biomol. Chem., 2009, 7, 869. |
|---|---|
| Market Analysis Reports |