| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Trans World Chemicals, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (301) 279-2295 | |||
![]() |
transworldchems@aol.com | |||
| Chemical manufacturer since 1974 | ||||
| Name | 2,3-Dihydroxy-4-[(4-Methylphenyl)Amino]-4-Oxobutanoic Acid |
|---|---|
| Synonyms | (-)-4'-Methyltartranilic acid; (+)-4'-Methyltartranilic acid; (+)-4'-METHYLTARTRANILICACID |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22 |
| CAS Registry Number | 206761-79-7 |
| SMILES | O=C(Nc1ccc(cc1)C)C(O)C(O)C(=O)O |
| InChI | 1S/C11H13NO5/c1-6-2-4-7(5-3-6)12-10(15)8(13)9(14)11(16)17/h2-5,8-9,13-14H,1H3,(H,12,15)(H,16,17) |
| InChIKey | XUPDOKFGWPFCPJ-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Melting point | 191-192°C (Expl.) |
| Boiling point | 576.285°C at 760 mmHg (Cal.) |
| Flash point | 302.326°C (Cal.) |
| Refractive index | 1.65 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| (1) | Powers RA, Morandi F, Shoichet BK. Structure-based discovery of a novel, noncovalent inhibitor of AmpC beta-lactamase., Structure. 2002 Jul;10(7):1013-23 |
|---|---|
| Market Analysis Reports |