| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,8-Bis(Methylamino)Naphthalene |
|---|---|
| Synonyms | Methyl-(8-Methylamino-1-Naphthyl)Amine; N,N'-Dimethyl-1,8-Naphthalenediamine; 1,8-Naphthalenediamine, N,N'-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 |
| CAS Registry Number | 20734-56-9 |
| SMILES | C1=CC=C(NC)C2=C(NC)C=CC=C12 |
| InChI | 1S/C12H14N2/c1-13-10-7-3-5-9-6-4-8-11(14-2)12(9)10/h3-8,13-14H,1-2H3 |
| InChIKey | XVOAHPOEMCETJM-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.998°C at 760 mmHg (Cal.) |
| Flash point | 229.315°C (Cal.) |
| (1) | K. Wozniak, C. C. Wilson, K. S. Knight, W. Jones and E. Grech. Neutron diffraction of a complex of 1,8-bis(dimethylamino)naphthalene with 1,2-dichloromaleic acid, Acta Cryst. (1996). B52, 691-696 |
|---|---|
| Market Analysis Reports |