| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Abacipharm Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 417-5545 | |||
![]() |
sales@abacipharm.com | |||
| Chemical manufacturer | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Annova Chem, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 434-2008 | |||
![]() |
sales@annovachem.com | |||
| Chemical manufacturer | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| Atomole Scientific Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| Bio-Vin Research Laboratories | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 380-4971 | |||
![]() |
sales@biovinresearch.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1,3-Dihydrobenzimidazole-2-Thione |
|---|---|
| Synonyms | Zinc00093995; Inchi=1/C7h6n2s/C10-7-8-5-3-1-2-4-6(5)9-7/H1-4H,(H2,8,9,10; 1,3-Dihydro-2H-Benzimidazole-2-Thione |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.20 |
| CAS Registry Number | 2080-59-3 |
| SMILES | C1=CC=CC2=C1NC(=S)N2 |
| InChI | 1S/C7H6N2S/c10-7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H2,8,9,10) |
| InChIKey | YHMYGUUIMTVXNW-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| 1.42 (Expl.) | |
| Melting point | 301-305°C (Expl.) |
| Boiling point | 332.1±25.0°C at 760 mmHg (Cal.) |
| Flash point | 154.7±23.2°C (Cal.) |
| 250°C (Expl.) | |
| solubility | Soluble in alcohol |
| Safety Code | S36;S60 Details |
|---|---|
| Risk Code | R22 Details |
| Hazard Symbol | X Details |
| Transport Information | UN2811 |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| DANGER: POISON, irritates skin, eyes, lungs | |
| Safety glasses, adequate ventilation. | |
| (1) | Ruiting Liu, Xiaoqing Li, Houcai Zhang, Linhong Weng and Xigeng Zhou. Synthesis and controlled hydrolysis of organolanthanide complexes with mono- and dianionic benzimidazole-2-thiolate ligands, Dalton Trans., 2010, 39, 11053. |
|---|---|
| Market Analysis Reports |