|
CAS#: 2085-31-6 Product: (1Z)-2-Diazonio-3-Oxo-1,3-Diphenyl-1-Propen-1-Olate No suppilers available for the product. |
| Name | (1Z)-2-Diazonio-3-Oxo-1,3-Diphenyl-1-Propen-1-Olate |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 2085-31-6 |
| SMILES | C1=CC=C(C=C1)/C(=C(\C(=O)C2=CC=CC=C2)/[N+]#N)/[O-] |
| InChI | 1S/C15H10N2O2/c16-17-13(14(18)11-7-3-1-4-8-11)15(19)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OOHAJTLMZFITEZ-UHFFFAOYSA-N |
| Refractive index | (Cal.) |
|---|---|
| (1) | Xu J, Zhang Q, Chen L, Chen H. Chemoselectivity in reactions of α-diazo-β-diketone with some conjugative double-bond systems, Perkin Transactions 1(18), 2001, 2266-2268 |
|---|---|
| Market Analysis Reports |