| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Name | Pyrrolo[2,1,5-Cd]Indolizine |
|---|---|
| Synonyms | Pyrrolo(2,1,5-Cd)Indolizine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7N |
| Molecular Weight | 141.17 |
| CAS Registry Number | 209-81-4 |
| SMILES | C1=C3[N]2C(=C1)C=CC=C2C=C3 |
| InChI | 1S/C10H7N/c1-2-8-4-6-10-7-5-9(3-1)11(8)10/h1-7H |
| InChIKey | DTPOQEUUHFQKSS-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| (1) | Jiaxin Hu, Xin Jiang, Ting He, Jian Zhou, Yuefei Hu and Hongwen Hu. Novel synthetic routes to nitrogen-bridged tricyclic derivatives of pyrrolo[2,1,5-cd]indolizine and pyrrolo[2,1,5-de]quinolizine derived from 2-acyl-N-(acylmethyl)pyridinium halides, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1820. |
|---|---|
| Market Analysis Reports |