| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Classification | Analytical chemistry >> Food safety >> Dioxins, polychlorinated biphenyls, furans |
|---|---|
| Name | 2,2',3,3',5,5',6,6'-Octachloro-1,1'-Biphenyl |
| Synonyms | 1,1'-Biphenyl, 2,2',3,3',5,5',6,6'-Octachloro-; 2,2',3,3',5,5',6,6'-Octachlorobiphenyl; 2,2',3,3',5,5',6,6'-Octachloro-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H2Cl8 |
| Molecular Weight | 429.77 |
| CAS Registry Number | 2136-99-4 |
| SMILES | C2=C(C(=C(C1=C(C(=CC(=C1Cl)Cl)Cl)Cl)C(=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl8/c13-3-1-4(14)10(18)7(9(3)17)8-11(19)5(15)2-6(16)12(8)20/h1-2H |
| InChIKey | JPOPEORRMSDUIP-UHFFFAOYSA-N |
| Density | 1.717g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.124°C at 760 mmHg (Cal.) |
| Flash point | 204.66°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |