| Enki Biopharmaceuticals (Shanghai) Limited | China | |||
|---|---|---|---|---|
![]() | www.enkibiopharma.com | |||
![]() | +86 (21) 5768-0965 +86 13916707528 | |||
![]() | +86 (21) 5768-0922 | |||
![]() | info@enkibiopharma.com | |||
![]() | QQ Chat | |||
| Chemical distributor since 2014 | ||||
| chemBlink Standard supplier since 2015 | ||||
| Classification | Organic raw materials >> Nitrile compound |
|---|---|
| Name | 4-[3-Formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-Benzonitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20BNO4 |
| Molecular Weight | 349.19 |
| CAS Registry Number | 2141947-89-7 |
| EC Number | 948-544-6 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC3=CC=C(C=C3)C#N)C=O |
| Density | 1.19±0.1 g/cm3 (20 °C 760 Torr), Calc.* |
|---|---|
| Index of Refraction | 1.566, Calc.* |
| Boiling point | 514.2±50.0 °C (760 Torr), Calc.* |
| Flash point | 264.8±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2021 ACD/Labs) |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H317-H412 Details | ||||||||||||||||
| Safety Statements | P261-P264-P270-P272-P273-P280-P301+P317-P302+P352-P321-P330-P333+P313-P362+P364-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
|
The discovery of 4-[3-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]benzonitrile, a boron-containing aromatic aldehyde, emerged from efforts to develop novel building blocks for organic synthesis and materials science. Researchers aimed to create a molecule combining the reactivity of formyl groups and the versatility of boronates in cross-coupling reactions. The synthesis involved coupling 3-formyl-4-hydroxybenzonitrile with a tetramethyl-1,3,2-dioxaborolane moiety using standard boronate esterification techniques. This compound provides a multifunctional scaffold, integrating a formyl group for further functionalization and a boronate ester for Suzuki-Miyaura cross-coupling, making it an innovative tool in the synthesis of complex organic molecules. The boronate ester moiety in this compound is highly valuable for Suzuki-Miyaura cross-coupling reactions, which are widely used to form carbon-carbon bonds in the synthesis of biaryl compounds. This enables the efficient construction of complex molecular architectures, including pharmaceuticals, natural products, and advanced materials. Its compatibility with various reaction conditions and substrates makes it a versatile intermediate in organic synthesis. The formyl group in this compound provides a reactive site for further chemical modifications. It can undergo reactions such as reductive amination, Knoevenagel condensation, and aldol reactions, allowing the introduction of diverse functionalities into the molecule. This versatility facilitates the synthesis of a wide range of derivatives with tailored properties for specific applications. In drug discovery, 4-[3-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]benzonitrile serves as a valuable building block for designing novel drug candidates. Its dual functionality enables the creation of complex molecular scaffolds with potential biological activity. Researchers can utilize this compound to explore structure-activity relationships and optimize pharmacological properties, leading to the development of new therapeutic agents. The boronate ester functionality can be exploited in the design of prodrugs that release active pharmaceutical ingredients upon metabolic activation. This strategy improves the bioavailability and targeted delivery of drugs. The formyl group can be used to attach bioactive moieties that, upon metabolic conversion, release the active drug in vivo, enhancing the efficacy and safety of therapeutics. This compound is useful in the synthesis of functional polymers with applications in electronics, optics, and coatings. The boronate ester can participate in polymerization reactions, while the formyl group allows for post-polymerization modifications. Such polymers can exhibit unique electronic, mechanical, or optical properties, making them suitable for advanced material applications. In organic electronics, the compound can be used to synthesize conjugated polymers and small molecules with tailored electronic properties. These materials can be applied in organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and organic field-effect transistors (OFETs), contributing to the development of flexible and efficient electronic devices. In the field of agrochemicals, this compound can be employed to synthesize novel pesticides and herbicides. The boronate ester allows for the efficient coupling of various aromatic rings, creating complex molecules with specific biological activities. These agrochemicals can target pest metabolic pathways or disrupt physiological processes in weeds, providing effective crop protection solutions. The compound's chemical versatility enables the design of plant growth regulators that modulate physiological responses in crops. By influencing growth, flowering, and stress tolerance, these regulators can improve agricultural productivity and resilience, addressing challenges in modern farming practices. Researchers use this compound to develop chemical probes for studying biological systems and chemical processes. Its dual functionality allows for the creation of probes that can interact with specific biological targets or track chemical reactions in living cells, advancing our understanding of complex biochemical networks. The compound is a subject of ongoing research in developing new synthetic methodologies. Studies focus on exploring its reactivity, optimizing reaction conditions, and discovering novel applications. Insights gained from these studies contribute to advancements in synthetic chemistry and the development of new chemical transformations. References none |
| Market Analysis Reports |