| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Anvia Chemicals, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (414) 534-7845 | |||
![]() |
sales@anviachem.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| ChemSampCo, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 656-2440 | |||
![]() |
sales@chemsampco.com | |||
| Chemical manufacturer since 1960 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| HBCChem, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (510) 219-6317 | |||
![]() |
sales@hbcchem-inc.com | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Classification | Chemical reagent >> Organic reagent >> Aromatic acid |
|---|---|
| Name | 2,3-Naphthalenedicarboxylicacid |
| Synonyms | St5437528; 2,3-Naphthalenedicarboxylic Acid; Nsc16063 |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 |
| CAS Registry Number | 2169-87-1 |
| EINECS | 218-517-7 |
| SMILES | C2=C1C=CC=CC1=CC(=C2C(O)=O)C(O)=O |
| InChI | 1S/C12H8O4/c13-11(14)9-5-7-3-1-2-4-8(7)6-10(9)12(15)16/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | KHARCSTZAGNHOT-UHFFFAOYSA-N |
| Density | 1.455g/cm3 (Cal.) |
|---|---|
| Melting point | 246°C (Expl.) |
| Boiling point | 407.465°C at 760 mmHg (Cal.) |
| Flash point | 214.384°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Shao-Ming Fang, Min Hu, Qiang Zhang, Miao Du and Chun-Sen Liu. Ag(i) and Zn(ii) coordination polymers with a bulky naphthalene-based dicarboxyl tecton and different 4,4′-bipyridyl-like bridging co-ligands: structural regulation and properties, Dalton Trans., 2011, 40, 4527. |
|---|---|
| Market Analysis Reports |