| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-(Pentylamino)Ethyl 4-Aminobenzoate |
|---|---|
| Synonyms | 4-Aminobenzoic Acid 2-(Pentylamino)Ethyl Ester; 4-Aminobenzoic Acid 2-(Amylamino)Ethyl Ester; Amylcain |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 2188-67-2 |
| SMILES | C1=CC(=CC=C1C(OCCNCCCCC)=O)N |
| InChI | 1S/C14H22N2O2/c1-2-3-4-9-16-10-11-18-14(17)12-5-7-13(15)8-6-12/h5-8,16H,2-4,9-11,15H2,1H3 |
| InChIKey | UYXHCVFXDBNRQW-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.605°C at 760 mmHg (Cal.) |
| Flash point | 197.289°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |