| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-Amino-4-(2-Amino-3-Hydroxy-3-Oxopropyl)Selanylbutanoic Acid |
|---|---|
| Synonyms | 2-Amino-4-(2-Amino-3-Hydroxy-3-Oxo-Propyl)Selanyl-Butanoic Acid; 2-Amino-4-[(2-Amino-3-Hydroxy-3-Oxopropyl)Seleno]Butanoic Acid; 2-Amino-4-[(2-Amino-3-Hydroxy-3-Keto-Propyl)Seleno]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14N2O4Se |
| Molecular Weight | 269.16 |
| CAS Registry Number | 2196-58-9 |
| SMILES | C(C(C(=O)O)N)C[Se]CC(C(=O)O)N |
| InChI | 1S/C7H14N2O4Se/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChIKey | ZNWYDQPOUQRDLY-UHFFFAOYSA-N |
| Boiling point | 489.433°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 249.801°C (Cal.) |
| (1) | Dernovics Mihaly. Standardless identification of selenocystathionine and its γ-glutamyl derivatives in monkeypot nuts by 3D liquid chromatography with ICP-MS detection followed by nanoHPLC-Q-TOF-MS/MS, The Analyst, 2007 |
|---|---|
| Market Analysis Reports |