| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | (9Z,12Z)-Octadeca-9,12-Dienoic Acid |
|---|---|
| Synonyms | 9-Cis,12-Cis-Linoleic Acid; 9Z,12Z-Linoleic Acid; Ai3-11132 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 |
| CAS Registry Number | 2197-37-7 |
| SMILES | C(C(=O)O)CCCCCC\C=C/C/C=C\CCCCC |
| InChI | 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9- |
| InChIKey | OYHQOLUKZRVURQ-HZJYTTRNSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| 20 (Expl.) | |
| Melting point | -5°C (Expl.) |
| Boiling point | 229-230°C (Expl.) |
| 360.552°C at 760 mmHg (Cal.) | |
| Flash point | 273.0±14.4°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.4699 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Not believed to present a hazard to health. | |
| IRRITANT | |
| CAUTION: May irritate skin and eyes | |
| (1) | Stefano LivraghiThese authors contributed equally to the study., Ingrid Corazzari, Maria Cristina Paganini, Giacomo Ceccone, Elio Giamello, Bice Fubini and Ivana Fenoglio. Decreasing the oxidative potential of TiO nanoparticles through modification of the surface with carbon: a new strategy for the production of safe UV filters, Chem. Commun., 2010, 46, 8478. |
|---|---|
| Market Analysis Reports |