| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dimethylnaphthalene-1,4-Dione |
|---|---|
| Synonyms | 2,3-Dimethyl-1,4-Naphthoquinone; Zinc03063275; 4-07-00-02434 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 2197-57-1 |
| SMILES | C1=CC=CC2=C1C(C(=C(C2=O)C)C)=O |
| InChI | 1S/C12H10O2/c1-7-8(2)12(14)10-6-4-3-5-9(10)11(7)13/h3-6H,1-2H3 |
| InChIKey | LGFDNUSAWCHVJN-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.491°C at 760 mmHg (Cal.) |
| Flash point | 116.926°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |