|
CAS#: 21987-62-2 Product: 3,3',5,5'-Tetrabromo-1,1'-biphenyl-2,2'-diol No suppilers available for the product. |
| Name | 3,3',5,5'-Tetrabromo-1,1'-biphenyl-2,2'-diol |
|---|---|
| Synonyms | 2,4-Dibromo-6-(3,5-Dibromo-2-Hydroxy-Phenyl)Phenol; (1,1'-Biphenyl)-2,2'-Diol, 3,3',5,5'-Tetrabromo-; 2,2'-Biphenyldiol, 3,3',5,5'-Tetrabromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Br4O2 |
| Molecular Weight | 501.79 |
| CAS Registry Number | 21987-62-2 |
| SMILES | C1=C(Br)C=C(C(=C1C2=CC(=CC(=C2O)Br)Br)O)Br |
| InChI | 1S/C12H6Br4O2/c13-5-1-7(11(17)9(15)3-5)8-2-6(14)4-10(16)12(8)18/h1-4,17-18H |
| InChIKey | TXODBIOSWNNKJM-UHFFFAOYSA-N |
| Density | 2.32g/cm3 (Cal.) |
|---|---|
| Melting point | 204-205°C (Expl.) |
| Boiling point | 393.88°C at 760 mmHg (Cal.) |
| Flash point | 192.012°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |