| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S)-2-Aminopropanoic Anhydride |
|---|---|
| Synonyms | (S)-2-aminopropanoic anhydride; Alanine anhydride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 |
| CAS Registry Number | 220190-44-3 |
| SMILES | C[C@@H](C(=O)OC(=O)[C@H](C)N)N |
| InChI | 1S/C6H12N2O3/c1-3(7)5(9)11-6(10)4(2)8/h3-4H,7-8H2,1-2H3/t3-,4-/m0/s1 |
| InChIKey | NHJBLCGVMVJTBN-IMJSIDKUSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.3±25.0°C at 760 mmHg (Cal.) |
| Flash point | 87.3±19.5°C (Cal.) |
| Refractive index | 1.479 (Cal.) |
| (1) | Darren L. ReidPresent address: Analytical Research and Development, Pfizer Inc., 2800 Plymouth Road, Ann Arbor, MI, USA, 48105., David A. Armstrong, Arvi Rauk, Chandrasekhar Nese, Man Nien Schuchmann, Ursula Westhoff and Clemens von SonntagPresent address: Leibniz-Institut für Oberflächenmodifizierung (IOM), Permoserstrasse 15, D-04303 Leipzig, Germany.. H-Atom abstraction by C-centered radicals from cyclic and acyclic dipeptides. A theoretical and experimental study of reaction rates, Phys. Chem. Chem. Phys., 2003, 5, 3278. |
|---|---|
| Market Analysis Reports |