|
CAS#: 22138-53-0 Product: L-Aspartic Acid, 4-Monoanhydride With Phosphoric Acid No suppilers available for the product. |
| Name | L-Aspartic Acid, 4-Monoanhydride With Phosphoric Acid |
|---|---|
| Synonyms | 2-Amino-4-Oxo-4-Phosphonooxy-Butanoic Acid; 2-Amino-4-Keto-4-Phosphonooxy-Butyric Acid; L-Aspartyl-Beta-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8NO7P |
| Molecular Weight | 213.08 |
| CAS Registry Number | 22138-53-0 |
| SMILES | C(C(C(=O)O)N)C(O[P](=O)(O)O)=O |
| InChI | 1S/C4H8NO7P/c5-2(4(7)8)1-3(6)12-13(9,10)11/h2H,1,5H2,(H,7,8)(H2,9,10,11) |
| InChIKey | IXZNKTPIYKDIGG-UHFFFAOYSA-N |
| Density | 1.839g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.945°C at 760 mmHg (Cal.) |
| Flash point | 260.391°C (Cal.) |
| Market Analysis Reports |