| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | Stemphylin |
|---|---|
| Synonyms | (1S,2R,3S,4R)-1,2,3,4,8-Pentahydroxy-6-Methoxy-3-Methyl-2,4-Dihydro-1H-Anthracene-9,10-Quinone; As-A 2; 9,10-Anthracenedione, 1,2,3,4-Tetrahydro-1,2,3,4,5-Pentahydroxy-7-Methoxy-2-Methyl-, (1R-(1Alpha,2Beta,3Beta,4Alpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 |
| CAS Registry Number | 22268-16-2 (55809-88-6) |
| SMILES | [C@]3([C@@H](C2=C(C(=O)C1=C(O)C=C(C=C1C2=O)OC)[C@H](O)[C@H]3O)O)(O)C |
| InChI | 1S/C16H16O8/c1-16(23)14(21)10-9(13(20)15(16)22)12(19)8-6(11(10)18)3-5(24-2)4-7(8)17/h3-4,13-15,17,20-23H,1-2H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | VSMBLBOUQJNJIL-JJXSEGSLSA-N |
| Density | 1.701g/cm3 (Cal.) |
|---|---|
| Boiling point | 656.883°C at 760 mmHg (Cal.) |
| Flash point | 246.467°C (Cal.) |
| (1) | Arnone Alberto, Assante Gemma, Caronna Tullio, Di Modugno Vincenza, Nasini Gianluca. Comparative evaluation of photodynamic efficiency of some natural quinonoid fungal toxins, Phytochemistry, 1988 |
|---|---|
| Market Analysis Reports |