| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 2-Arachidonyl glycerol ether |
|---|---|
| Synonyms | Noladin Ether; Aids-342674; Aids342674 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 |
| CAS Registry Number | 222723-55-9 |
| SMILES | C(C(OCCCC\C=C/C/C=C\C\C=C/C/C=C\CCCCC)CO)O |
| InChI | 1S/C23H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-23(21-24)22-25/h6-7,9-10,12-13,15-16,23-25H,2-5,8,11,14,17-22H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | CUJUUWXZAQHCNC-DOFZRALJSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.865°C at 760 mmHg (Cal.) |
| Flash point | 249.457°C (Cal.) |
| solubility | Soluble in ethanol (supplied pre-dissolved in anhydrous ethanol, 5mg/ml) |
| SDS | Available |
|---|---|
| (1) | Sharon M. Sagnella, Charlotte E. Conn, Irena Krodkiewska, Xavier Mulet and Calum J. Drummond. Anandamide and analogous endocannabinoids: a lipid self-assembly study, Soft Matter, 2011, 7, 5319. |
|---|---|
| Market Analysis Reports |