Online Database of Chemicals from Around the World

1-(4-Nitrophenyl)piperidine-4-carboxylic acid
[CAS 223786-53-6]

List of Suppliers
Zhengzhou Kingorgchem Chemical Technology Co., Ltd. China
www.kingorgchem.com
+86 (371) 6551-1006
+86 (371) 6575-6965
sales@kingorgchem.com
QQ Chat
WeChat: 18625597674
Chemical manufacturer since 2015
chemBlink Standard supplier since 2016

Identification
ClassificationOrganic raw materials >> Heterocyclic compound >> Piperidines
Name1-(4-Nitrophenyl)piperidine-4-carboxylic acid
Molecular Structure1-(4-Nitrophenyl)piperidine-4-carboxylic acid molecular structure (CAS 223786-53-6)
Molecular FormulaC12H14N2O4
Molecular Weight250.25
CAS Registry Number223786-53-6
SMILESC1CN(CCC1C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-]
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP280-P301+P312-P302+P352-P304+P340-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
1-(4-Nitrophenyl)piperidine-4-carboxylic acid is a chemical compound of considerable interest in medicinal chemistry and organic synthesis. This substance combines a piperidine ring with a nitrophenyl group and a carboxylic acid moiety, making it a versatile building block for various chemical applications.

The discovery of 1-(4-Nitrophenyl)piperidine-4-carboxylic acid was driven by its potential applications in pharmaceutical chemistry. The compound's structure includes a piperidine ring, which is a common motif in drug design due to its ability to interact with biological targets. The nitrophenyl group serves as a functional handle for further chemical modifications, while the carboxylic acid group facilitates its use in various reactions.

In terms of applications, 1-(4-Nitrophenyl)piperidine-4-carboxylic acid is primarily used as an intermediate in the synthesis of pharmaceuticals and other bioactive molecules. Its ability to undergo further chemical transformations makes it a valuable precursor in the development of complex drug candidates. For example, it can be utilized in the synthesis of compounds with potential therapeutic properties, including those targeting central nervous system disorders.

The compound’s utility extends beyond pharmaceuticals. Its structural features also make it a useful reagent in organic synthesis for creating other complex molecules. The piperidine ring's versatility allows for the introduction of various substituents, while the nitrophenyl group provides opportunities for further functionalization.

Overall, 1-(4-Nitrophenyl)piperidine-4-carboxylic acid represents a significant advancement in chemical synthesis. Its role as a versatile intermediate underscores its importance in both drug development and organic chemistry. The compound's ability to participate in diverse chemical reactions makes it a valuable tool for researchers and chemists aiming to create new and innovative molecules.

References

2024. In Silico Design, Synthesis, and Evaluation of PROTAC Against Hematopoietic Prostaglandin D Synthase. *Methods in Molecular Biology (Clifton, N.J.)*.
DOI: 10.1007/978-1-0716-3985-6_18
Market Analysis Reports
Related Products
1-(4-Nitropheny...  4-(2-Nitropheny...  4-(3-Nitropheny...  N-(4-Nitropheny...  N-(3-Nitropheny...  N-(4-Nitropheny...  N-(2-Nitropheny...  N-(3-Nitropheny...  N-(2-Nitropheny...  3-Nitrophenyl 3...  1-(2-nitropheny...  4-(4-nitropheny...  4-(4-Nitropheny...  alpha-(4-Nitrop...  1-(4-Nitropheny...  1-(4-Nitropheny...  [1-(2-Nitro-phe...  (2-Nitrophenyl)...  3-Nitro-N-[1-ph...  2-(4-Nitropheny...