|
CAS#: 22439-58-3 Product: 2-Acetyldibenzothiophene No suppilers available for the product. |
| Name | 2-Acetyldibenzothiophene |
|---|---|
| Synonyms | 1-(2-Dibenzothiophenyl)Ethanone; 2-Acetyldibenzothiophene; Dibenzothien-2-Yl Methyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10OS |
| Molecular Weight | 226.29 |
| CAS Registry Number | 22439-58-3 |
| SMILES | C3=C2C1=C(C=CC=C1)SC2=CC=C3C(C)=O |
| InChI | 1S/C14H10OS/c1-9(15)10-6-7-14-12(8-10)11-4-2-3-5-13(11)16-14/h2-8H,1H3 |
| InChIKey | NTHRMQKFNGUJPH-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.608°C at 760 mmHg (Cal.) |
| Flash point | 197.291°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |