| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | Trimethyl-(3-Trimethylsilylbuta-1,3-Dien-2-Yl)Silane |
|---|---|
| Synonyms | Trimethyl-(1-Methylene-2-Trimethylsilyl-Prop-2-Enyl)Silane; Trimethyl-(1-Methylene-2-Trimethylsilylprop-2-Enyl)Silane; 2,5-Disilahexane, 2,2,5,5-Tetramethyl-3,4-Dimethylene- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22Si2 |
| Molecular Weight | 198.46 |
| CAS Registry Number | 22472-36-2 |
| SMILES | C[Si](C)(C)C(C(=C)[Si](C)(C)C)=C |
| InChI | 1S/C10H22Si2/c1-9(11(3,4)5)10(2)12(6,7)8/h1-2H2,3-8H3 |
| InChIKey | RJSCYACDEKOHFB-UHFFFAOYSA-N |
| Density | 0.779g/cm3 (Cal.) |
|---|---|
| Boiling point | 185.125°C at 760 mmHg (Cal.) |
| Flash point | 47.217°C (Cal.) |
| (1) | Babudri Francesco. A novel cyclization reaction between 2,3-bis(trimethylsilyl)buta-1,3-diene and acyl chlorides with straightforward formation of polysubstituted furans, Chemical Communications, 2007 |
|---|---|
| Market Analysis Reports |