| Chizhou Dongsheng Pharmaceutical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.dspharmchem.com | |||
![]() | +86 (576) 8429-2571 | |||
![]() | +86 (576) 8429-2560 | |||
![]() | ksz@dspharmchem.com | |||
| Chemical manufacturer since 1995 | ||||
| chemBlink Premium supplier since 2011 | ||||
| Hangzhou Verychem Science And Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.verychem.com | |||
![]() | +86 (571) 8816-2785 +86 13606544505 | |||
![]() | +86 (571) 8816-2787 | |||
![]() | lucy@verychem.com | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink Massive supplier since 2021 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Imidazoles |
|---|---|
| Name | 2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 |
| CAS Registry Number | 224789-21-3 |
| EC Number | 607-089-0 |
| SMILES | CCCC1=NC(=C2N1N=C(NC2=O)C3=CC=CC=C3OCC)C |
| Hazard Symbols | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H317-H411 Details | ||||||||||||
| Safety Statements | P261-P272-P273-P280-P302+P352-P321-P333+P317-P362+P364-P391-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
|
2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one is a complex heterocyclic compound that has gained interest in the field of organic chemistry and medicinal research. This compound belongs to the imidazo[5,1-f][1,2,4]triazin-4-one family, which is characterized by a fused triazine and imidazole ring system with a variety of substituents that influence its chemical and biological properties. The discovery of 2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one is rooted in the exploration of heterocyclic compounds with potential biological activity. The imidazo[5,1-f][1,2,4]triazin-4-one structure provides a unique framework for the introduction of various substituents, which can be tailored to modulate the compound's reactivity and interaction with biological targets. The synthesis of this compound typically involves the formation of the imidazo[5,1-f][1,2,4]triazin-4-one ring system followed by the introduction of ethoxyphenyl, methyl, and propyl groups at specific positions. The primary application of 2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one is in medicinal chemistry, where it serves as a scaffold for the development of new pharmacological agents. The imidazo[5,1-f][1,2,4]triazin-4-one core is known for its potential to interact with a range of biological targets, including enzymes, receptors, and nucleic acids. By modifying the substituents on the core structure, researchers aim to enhance the compound's biological activity and selectivity. One significant application of this compound is in the development of antiparasitic and antimicrobial agents. The imidazo[5,1-f][1,2,4]triazin-4-one structure has shown promise in targeting protozoan parasites and bacteria, making it a valuable starting point for designing drugs to combat infectious diseases. The ethoxyphenyl, methyl, and propyl substituents can influence the compound's pharmacokinetic properties, such as solubility, stability, and bioavailability, which are crucial for effective drug development. Additionally, 2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one is explored for its potential as an anti-cancer agent. The compound's ability to interact with specific cellular targets or pathways may contribute to its efficacy in treating various types of cancer. Research into its mechanism of action and therapeutic potential is ongoing, with the goal of developing effective treatments for cancer and other diseases. The synthesis of 2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one involves multi-step procedures, including the formation of the imidazo[5,1-f][1,2,4]triazin-4-one core and subsequent functionalization with the ethoxyphenyl, methyl, and propyl groups. These steps are carried out under controlled conditions to ensure the formation of the desired compound with high purity. In summary, 2-(2-Ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one is a notable compound in the field of medicinal chemistry due to its unique heterocyclic structure and potential applications in drug development. Its role as a scaffold for designing antiparasitic, antimicrobial, and anti-cancer agents highlights its significance in the pursuit of new therapeutic solutions. References 2008. In silico prediction of novel phosphodiesterase type-5 inhibitors derived from Sildenafil, Vardenafil and Tadalafil. *Bioorganic & Medicinal Chemistry*, 16(16). DOI: 10.1016/j.bmc.2008.07.022 2005. Comparison of different heterocyclic scaffolds as substrate analog PDE5 inhibitors. *Bioorganic & Medicinal Chemistry Letters*, 15(17). DOI: 10.1016/j.bmcl.2005.05.090 2002. Imidazo[5,1-f][1,2,4]triazin-4(3H)-ones, a new class of potent PDE 5 inhibitors. *Bioorganic & Medicinal Chemistry Letters*, 12(6). DOI: 10.1016/s0960-894x(02)00030-6 |
| Market Analysis Reports |