| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-(4-Nitrophenoxy)Phenol |
|---|---|
| Synonyms | Zinc00370769; Stk290963; 4-(4-Nitro-Phenoxy)-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 |
| CAS Registry Number | 22479-78-3 |
| SMILES | C2=C(OC1=CC=C(O)C=C1)C=CC(=C2)[N+](=O)[O-] |
| InChI | 1S/C12H9NO4/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h1-8,14H |
| InChIKey | DCCDSAOUQRQDEL-UHFFFAOYSA-N |
| Density | 1.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.109°C at 760 mmHg (Cal.) |
| Flash point | 184.893°C (Cal.) |
| (1) | Archan Dey and Gautam R. Desiraju. Correlation between molecular dipole moment and centrosymmetry in some crystalline diphenyl ethers, Chem. Commun., 2005, 0, 2486. |
|---|---|
| Market Analysis Reports |