| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 12H-Benzo[a]Phenothiazine |
|---|---|
| Synonyms | Nsc 88195; (12H)-Benzo(A)Phenothiazine; Benzophenothiazine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11NS |
| Molecular Weight | 249.33 |
| CAS Registry Number | 225-83-2 (28453-74-9) |
| EINECS | 205-931-8 |
| SMILES | C1=CC=CC2=C1SC3=C(N2)C4=C(C=C3)C=CC=C4 |
| InChI | 1S/C16H11NS/c1-2-6-12-11(5-1)9-10-15-16(12)17-13-7-3-4-8-14(13)18-15/h1-10,17H |
| InChIKey | PGIGZWJIJSINOD-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.716°C at 760 mmHg (Cal.) |
| Flash point | 236.666°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |