| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Isochromeno[4,3-c]Chromene-6,11-Dione |
|---|---|
| Synonyms | Isochromeno[4,3-C]Chromene-6,11-Quinone; A2569/0109507; Zinc00129814 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H8O4 |
| Molecular Weight | 264.24 |
| CAS Registry Number | 2288-98-4 |
| SMILES | C1=CC=CC2=C1C4=C(OC2=O)C3=CC=CC=C3OC4=O |
| InChI | 1S/C16H8O4/c17-15-10-6-2-1-5-9(10)13-14(20-15)11-7-3-4-8-12(11)19-16(13)18/h1-8H |
| InChIKey | CQOQPUAAVDHXQM-UHFFFAOYSA-N |
| Density | 1.493g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.636°C at 760 mmHg (Cal.) |
| Flash point | 260.463°C (Cal.) |
| (1) | Heiko Leutbecher, Gerhard Greiner, Robert Amann, Andreas Stolz, Uwe Beifuss and Jürgen Conrad. Laccase-catalyzed phenol oxidation. Rapid assignment of ring-proton deficient polycyclic benzofuran regioisomers by experimental H–C long-range coupling constants and DFT-predicted product formation, Org. Biomol. Chem., 2011, 9, 2667. |
|---|---|
| Market Analysis Reports |