| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Isopropyl Linoleate |
| Synonyms | Isopropyl (9Z,12Z)-Octadeca-9,12-Dienoate; (9Z,12Z)-Octadeca-9,12-Dienoic Acid Isopropyl Ester; 1-Methylethyl-9,12-Octadecadienoate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 |
| CAS Registry Number | 22882-95-7 |
| EINECS | 245-289-6 |
| SMILES | C(C(OC(C)C)=O)CCCCCC\C=C/C/C=C\CCCCC |
| InChI | 1S/C21H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20(2)3/h8-9,11-12,20H,4-7,10,13-19H2,1-3H3/b9-8-,12-11- |
| InChIKey | XEIOPEQGDSYOIH-MURFETPASA-N |
| Density | 0.881g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.97°C at 760 mmHg (Cal.) |
| Flash point | 92.936°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |