| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Silar Laboratories | USA | |||
|---|---|---|---|---|
![]() |
+1 (910) 762-5800 | |||
![]() |
info@silar.com | |||
| Chemical manufacturer | ||||
| Name | 1,1-Dimethylsiletane |
|---|---|
| Synonyms | Silacyclobutane, 1,1-Dimethyl-; Inchi=1/C5h12si/C1-6(2)4-3-5-6/H3-5H2,1-2H; 1,1-Dimethyl-1-Silacyclobutane |
| Molecular Formula | C5H12Si |
| Molecular Weight | 100.24 |
| CAS Registry Number | 2295-12-7 |
| EINECS | 218-939-1 |
| SMILES | C[Si]1(CCC1)C |
| InChI | 1S/C5H12Si/c1-6(2)4-3-5-6/h3-5H2,1-2H3 |
| InChIKey | YQQFFTNDQFUNHB-UHFFFAOYSA-N |
| Density | 0.785g/cm3 (Cal.) |
|---|---|
| Boiling point | 81.802°C at 760 mmHg (Cal.) |
| Flash point | -12.074°C (Cal.) |
| Refractive index | 1.429 (Expl.) |
| SDS | Available |
|---|---|
| (1) | B. D. Eustergerling, M. Hedén and Y. J. Shi. Development of a new laser induced electron impact ionization source for studying the hot-wire chemical vapor deposition chemistry of silane–ammonia mixtures, J. Anal. Atom. Spectrosc., 2008, 23, 1590. |
|---|---|
| Market Analysis Reports |