| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Syntastic AB | Sweden | |||
|---|---|---|---|---|
![]() |
+46 (70) 592-7309 | |||
![]() |
sales@syntastic.se | |||
| Chemical manufacturer | ||||
| Name | 1H-Benzo[g]Indole |
|---|---|
| Synonyms | St5411840; 1H-Benz[G]Indole; Nsc153687 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 |
| CAS Registry Number | 233-34-1 |
| SMILES | C1=C3C(=C2C(=C1)C=CC=C2)[NH]C=C3 |
| InChI | 1S/C12H9N/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-8,13H |
| InChIKey | HIYWOHBEPVGIQN-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.068°C at 760 mmHg (Cal.) |
| Flash point | 168.755°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Xufeng Lin, Zhenjun Mao, Xixiang Dai, Ping Lu and Yanguang Wang. A straightforward one-pot multicomponent synthesis of polysubstituted pyrroles, Chem. Commun., 2011, 47, 6620. |
|---|---|
| Market Analysis Reports |