| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Diethyl (2E)-2-Benzylidenesuccinate |
|---|---|
| Synonyms | (E)-diethyl 2-benzylidenesuccinate; 2-[1-PHENYL-METH-(E)-YLIDENE]-SUCCINICACIDDIETHYLESTER; diethyl 2-benzylidenesuccinate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 |
| CAS Registry Number | 23360-64-7 |
| SMILES | CCOC(=O)C/C(=C\C1=CC=CC=C1)/C(=O)OCC |
| InChI | 1S/C15H18O4/c1-3-18-14(16)11-13(15(17)19-4-2)10-12-8-6-5-7-9-12/h5-10H,3-4,11H2,1-2H3/b13-10+ |
| InChIKey | KYFSKKXDQHJWKR-JLHYYAGUSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.0±30.0°C at 760 mmHg (Cal.) |
| Flash point | 186.8±23.0°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| (1) | Gonzalo Villaverde, Avelina Arnanz, Marta Iglesias, Angeles Monge, Félix Sánchez and Natalia Snejko. Development of homogeneous and heterogenized rhodium(i) and palladium(ii) complexes with ligands based on a chiral proton sponge building block and their application as catalysts, Dalton Trans., 2011, 40, 9589. |
|---|---|
| Market Analysis Reports |