| AEchem Scientific Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (630) 364-5106 | |||
![]() |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Proactive Molecular Research | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 505-2681 | |||
![]() |
tony@proactivemr.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | 2-Fluoro-DL-phenylglycine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.16 |
| CAS Registry Number | 2343-27-3 |
| SMILES | [C@H]([NH3+])(C1=C(F)C=CC=C1)C([O-])=O |
| InChI | 1S/C8H8FNO2/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/m0/s1 |
| InChIKey | CGNMJIBUVDGMIY-ZETCQYMHSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.08°C at 760 mmHg (Cal.) |
| Flash point | 125.003°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |