| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 2-Aminonaphthalene-1,4-Dione |
|---|---|
| Synonyms | 2-Amino-1,4-Naphthoquinone; 1,4-Naphthoquinone, 2-Amino- (8Ci); Nsc 7936 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 2348-81-4 |
| SMILES | C1=CC=CC2=C1C(=O)C(=CC2=O)N |
| InChI | 1S/C10H7NO2/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-5H,11H2 |
| InChIKey | CYCRZLRIJWDWCM-UHFFFAOYSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.178°C at 760 mmHg (Cal.) |
| Flash point | 152.882°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |