| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1-(4-Chlorophenyl)-N-Phenylmethanimine |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-N-Phenyl-Methanimine; (4-Chlorobenzylidene)-Phenyl-Amine; Nsc43310 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 |
| CAS Registry Number | 2362-79-0 |
| SMILES | C2=C(C=NC1=CC=CC=C1)C=CC(=C2)Cl |
| InChI | 1S/C13H10ClN/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-10H |
| InChIKey | CFBVFBIZXQEQHX-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.013°C at 760 mmHg (Cal.) |
| Flash point | 151.573°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Nongkunsarn P, Ramsden C A. Oxidative rearrangement of imines to formamides using sodium perborate, Tetrahedron, 1997, 53(10), 3805-3830 |
|---|---|
| Market Analysis Reports |