| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | (1,3,3,3-Tetrachloropropyl)Benzene |
|---|---|
| Synonyms | Benzene, (1,3,3,3-Tetrachloropropyl)-; Inchi=1/C9h8cl4/C10-8(6-9(11,12)13)7-4-2-1-3-5-7/H1-5,8H,6H; (1,3,3,3-Tetrachloropropyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8Cl4 |
| Molecular Weight | 257.97 |
| CAS Registry Number | 23691-27-2 |
| EINECS | 245-824-3 |
| SMILES | C1=C(C(Cl)CC(Cl)(Cl)Cl)C=CC=C1 |
| InChI | 1S/C9H8Cl4/c10-8(6-9(11,12)13)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | JJRCOEWDFJHOFK-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.077°C at 760 mmHg (Cal.) |
| Flash point | 137.023°C (Cal.) |
| (1) | Jianyang Weng, Congmin Wang, Haoran Li and Yong Wang. Novel quaternary ammonium ionic liquids and their use as dual solvent-catalysts in the hydrolytic reaction, Green Chem., 2006, 8, 96. |
|---|---|
| Market Analysis Reports |