| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | D-Alprenolol |
|---|---|
| Synonyms | 1-(2-Allylphenoxy)-3-(Isopropylamino)Propan-2-Ol; Spectrum2_001814; Spectrum_000168 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 |
| CAS Registry Number | 23846-72-2 |
| SMILES | C1=CC=CC(=C1OCC(CNC(C)C)O)CC=C |
| InChI | 1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 |
| InChIKey | PAZJSJFMUHDSTF-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.4±37.0°C at 760 mmHg (Cal.) |
| Flash point | 185.7±26.5°C (Cal.) |
| (1) | Mario Orsi and Jonathan W. Essex. Permeability of drugs and hormones through a lipid bilayer: insights from dual-resolution molecular dynamics, Soft Matter, 2010, 6, 3797. |
|---|---|
| Market Analysis Reports |