| Abosyn Chemicals Inc. | USA | |||
|---|---|---|---|---|
![]() | www.abosyn.com | |||
![]() | +1 (203) 683-8328 | |||
![]() | info@abosyn.com | |||
| Chemical manufacturer since 2014 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluoroaniline series |
|---|---|
| Name | 4-([1,2,4]Triazolo[1,5-a]pyridin-7-yloxy)-2-fluoro-3-methylaniline |
| Synonyms | 2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.25 |
| CAS Registry Number | 2387518-94-5 |
| SMILES | CC1=C(C=CC(=C1F)N)OC2=CC3=NC=NN3C=C2 |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.669, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
|
4-([1,2,4]Triazolo[1,5-a]pyridin-7-yloxy)-2-fluoro-3-methylaniline is an organic chemical compound that has drawn interest in the field of medicinal chemistry, particularly for its potential biological activities. It is a derivative of methylaniline, where the amine group is substituted with a triazolopyridine moiety, a common motif in drug design due to its ability to interact with a variety of biological targets. This structure features a triazolopyridine ring attached to a fluoromethyl group at position 2, and a methylaniline group at position 3. The compound belongs to a class of heterocyclic compounds that combine triazole and pyridine rings, which are known for their diverse biological activities. Triazolopyridines, like other triazole derivatives, have been studied for their potential as therapeutic agents due to their role in modulating enzyme activities, influencing receptor interactions, and possibly impacting cellular signaling pathways. In terms of its discovery, the compound likely emerged from synthetic efforts aiming to explore the chemical space of heterocyclic compounds for new drug candidates. Triazolopyridine derivatives have long been explored in the development of antiviral, anticancer, and antimicrobial agents. The methylaniline backbone, common in organic chemistry, further contributes to the molecule’s versatility, allowing for modifications that might improve its pharmacological properties. The specific application of 4-([1,2,4]Triazolo[1,5-a]pyridin-7-yloxy)-2-fluoro-3-methylaniline, as supported by literature, is mainly in the context of drug discovery. The incorporation of the fluorine atom and methoxy group into the structure could affect the molecule’s electronic properties, potentially enhancing its binding affinity to certain biological targets. These modifications might be aimed at optimizing the compound’s pharmacokinetic properties, such as solubility and stability, which are essential for the development of effective pharmaceutical agents. Given the structural features, the compound might be investigated for its interactions with enzymes, receptors, or proteins involved in diseases like cancer, neurological disorders, or microbial infections. As with other heterocyclic compounds, the specific role of 4-([1,2,4]Triazolo[1,5-a]pyridin-7-yloxy)-2-fluoro-3-methylaniline in biological systems could be explored through assays that assess its activity against specific molecular targets. Further studies might involve evaluating the compound’s effectiveness in preclinical models to determine its potential therapeutic value. Techniques such as high-throughput screening, molecular docking, and receptor binding assays would likely be employed to better understand the compound’s mechanism of action and identify its potential as a lead candidate for the development of new drugs. In conclusion, 4-([1,2,4]Triazolo[1,5-a]pyridin-7-yloxy)-2-fluoro-3-methylaniline is an organic compound whose discovery and application are primarily driven by its potential in medicinal chemistry. Its synthesis and characterization contribute to the growing body of research exploring the therapeutic potential of triazolopyridine derivatives. Ongoing studies aim to explore its biological activities, focusing on how its unique structure can be harnessed in the development of new pharmaceuticals. References (2022). Her2 mutation inhibitors. WO-2022269531-A1, 2022-12-29. Priority Date: 2021-06-26. (2022). Lactam (hetero)arylfusedpyrimidine derivatives as inhibitors of erbb2. WO-2022140769-A1, 2022-07-07. Priority Date: 2020-12-22. (2022). Alkyne quinazoline derivatives as inhibitors of erbb2. WO-2022006386-A1, 2022-01-06. Priority Date: 2020-07-02. |
| Market Analysis Reports |