| Pure Research Chemicals | China | |||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | Methopterin |
| Synonyms | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21N7O6 |
| Molecular Weight | 455.42 |
| Protein Sequence | XE |
| CAS Registry Number | 2410-93-7 |
| EC Number | 691-132-3 |
| SMILES | CN(CC1=CN=C2C(=N1)C(=O)NC(=N2)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Solubility | 5738 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.733, Calc.* |
| Melting point | 349.84 °C |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H319-H341-H351-H361 Details | ||||||||||||||||
| Safety Statements | P203-P264-P264+P265-P270-P280-P281-P301+P317-P302+P352-P305+P351+P338-P318-P321-P330-P332+P317-P337+P317-P362+P364-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |