| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Name | (3,4-Dimethylphenyl) N-Methylcarbamate |
|---|---|
| Synonyms | N-Methylcarbamic Acid (3,4-Dimethylphenyl) Ester; C14579; 3,4-Dimethylphenyl Methylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| CAS Registry Number | 2425-10-7 |
| EINECS | 219-364-9 |
| SMILES | C1=C(OC(NC)=O)C=CC(=C1C)C |
| InChI | 1S/C10H13NO2/c1-7-4-5-9(6-8(7)2)13-10(12)11-3/h4-6H,1-3H3,(H,11,12) |
| InChIKey | WCJYTPVNMWIZCG-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.487°C at 760 mmHg (Cal.) |
| Flash point | 116.177°C (Cal.) |
| (1) | Bryce J. Marquis, Melissa A. Maurer-Jones, Katherine L. Braun and Christy L. Haynes. Amperometric assessment of functional changes in nanoparticle-exposed immune cells: varying Au nanoparticle exposure time and concentration, Analyst, 2009, 134, 2293. |
|---|---|
| Market Analysis Reports |