| Ereztech LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (888) 658-1221 | |||
![]() |
sales@ereztech.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2017 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic germanium, cobalt, strontium, barium, gallium, germanium, germanium, germanium, germanium, etc. |
|---|---|
| Name | Barium Di(2-Propanolate) |
| Synonyms | BARIUM ISOPROPOXIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14BaO2 |
| Molecular Weight | 255.50 |
| CAS Registry Number | 24363-37-9 |
| SMILES | CC(C)[O-].CC(C)[O-].[Ba+2] |
| InChI | 1S/2C3H7O.Ba/c2*1-3(2)4;/h2*3H,1-2H3;/q2*-1;+2 |
| InChIKey | CPUJSIVIXCTVEI-UHFFFAOYSA-N |
| Density | 0.89 (Expl.) |
|---|---|
| Melting point | 200°C (Expl.) |
| Flash point | 22°C (Expl.) |
| Refractive index | (Cal.) |
| Safety Code | S16;S26;S28;S36/37/39;S45 Details |
|---|---|
| Risk Code | R11;R20/22;R34 Details |
| Hazard Symbol | X;C;F Details |
| Transport Information | UN3205 |
| Safety Description | DANGER: FLAMMABLE, CORROSIVE, burns skin and eyes |
| DANGER: FLAMMABLE, burns skin and eyes | |
| SDS | Available |
| Market Analysis Reports |