| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Syntastic AB | Sweden | |||
|---|---|---|---|---|
![]() |
+46 (70) 592-7309 | |||
![]() |
sales@syntastic.se | |||
| Chemical manufacturer | ||||
| Name | 1,2,4,5-Tetramethoxy-Benzene |
|---|---|
| Synonyms | Asarol Methyl Ether; Benzene, 1,2,4,5-Tetramethoxy-; Nsc144256 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 2441-46-5 |
| SMILES | C1=C(OC)C(=CC(=C1OC)OC)OC |
| InChI | 1S/C10H14O4/c1-11-7-5-9(13-3)10(14-4)6-8(7)12-2/h5-6H,1-4H3 |
| InChIKey | JUVJUCAKSWHQEE-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.1°C at 760 mmHg (Cal.) |
| Flash point | 112.546°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Minoru Yamaji, Takao Itoh and Seiji Tobita. Photochemical properties of the triplet p,p* state, anion and ketyl radicals of 5,12-naphthacenequinone in solution studied by laser flash photolysis: electron transfer and phenolic H-atom transfer, Photochem. Photobiol. Sci., 2002, 1, 869. |
|---|---|
| Market Analysis Reports |